Name | L-Arginine-L-pyroglutamate |
Synonyms | arg-pyr L-Arg-L-Pyr ARGININE PCA L-Argenine-L-Pyroglutamic L-Arginine-L-pyroglutamate L-ARGININE PYROGLUTAMIC ACID L-Arginine L-Pyroglutamic acid L-Arginine-L-Pyroglutamic acid L-Arginine Pyroglutamate (Micropellet) |
CAS | 56265-06-6 |
EINECS | 260-081-5 |
InChI | InChI=1/C6H14N4O2.C5H7NO3/c7-4(5(11)12)2-1-3-10-6(8)9;7-4-2-1-3(6-4)5(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3H,1-2H2,(H,6,7)(H,8,9)/t4-;3-/m00/s1 |
Molecular Formula | C11H21N5O5 |
Molar Mass | 303.31 |
Boling Point | 409.1°C at 760 mmHg |
Flash Point | 201.2°C |
Vapor Presure | 7.7E-08mmHg at 25°C |
Appearance | White powder |
Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
Sensitive | Easily absorbing moisture |
Use | Can effectively increase the level of human hormones, enhance the function of human muscles and ligaments, increase the explosive force during exercise |
Use | can effectively increase the level of human hormones, enhance the function of human muscles and ligaments, increase power during exercise |